C30H44N4O8S2 — CID 70320644
(1S,4R,7Z,14S)-14-[[3,3-dimethyl-1-[methyl(thiophen-2-ylsulfonyl)amino]butan-2-yl]oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylic acid (PubChem CID 70320644) has the molecular formula C30H44N4O8S2 and a molecular weight of 652.84 g/mol. Its IUPAC name is (1S,4R,7Z,14S)-14-[[3,3-dimethyl-1-[methyl(thiophen-2-ylsulfonyl)amino]butan-2-yl]oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylic acid.
| Compound Name | (1S,4R,7Z,14S)-14-[[3,3-dimethyl-1-[methyl(thiophen-2-ylsulfonyl)amino]butan-2-yl]oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 70320644 |
| Molecular Formula | C30H44N4O8S2 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | (1S,4R,7Z,14S)-14-[[3,3-dimethyl-1-[methyl(thiophen-2-ylsulfonyl)amino]butan-2-yl]oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylic acid |
| SMILES | CN(CC(OC(=O)N[C@H]1CCCCC/C=C\C2C[C@@]2(C(=O)O)NC(=O)[C@@H]2CCCN2C1=O)C(C)(C)C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C30H44N4O8S2/c1-29(2,3)23(19-33(4)44(40,41)24-15-11-17-43-24)42-28(39)31-21-13-9-7-5-6-8-12-20-18-30(20,27(37)38)32-25(35)22-14-10-16-34(22)26(21)36/h8,11-12,15,17,20-23H,5-7,9-10,13-14,16,18-19H2,1-4H3,(H,31,39)(H,32,35)(H,37,38)/b12-8-/t20?,21-,22-,23?,30+/m0/s1 |
| InChIKey | CNXUZDAFDKBNIL-YRPQODMSSA-N |
| XLogP | 3.35 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|