C8H8N4O4 — CID 70320847
2-(aminomethylideneamino)-6-methoxycarbonylpyrimidine-4-carboxylic acid (PubChem CID 70320847) has the molecular formula C8H8N4O4 and a molecular weight of 224.18 g/mol. Its IUPAC name is 2-(aminomethylideneamino)-6-methoxycarbonylpyrimidine-4-carboxylic acid.
| Compound Name | 2-(aminomethylideneamino)-6-methoxycarbonylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 70320847 |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-(aminomethylideneamino)-6-methoxycarbonylpyrimidine-4-carboxylic acid |
| SMILES | COC(=O)c1cc(C(=O)O)nc(N=CN)n1 |
| InChI | InChI=1S/C8H8N4O4/c1-16-7(15)5-2-4(6(13)14)11-8(12-5)10-3-9/h2-3H,1H3,(H,13,14)(H2,9,10,11,12) |
| InChIKey | YRCDFIRXVOWDLP-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|