C18H28N4O4 — CID 70321456
3-amino-N-[2-[[1-cyclohexa-1,3-dien-1-yl-2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl]-2-oxohexanamide (PubChem CID 70321456) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-amino-N-[2-[[1-cyclohexa-1,3-dien-1-yl-2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl]-2-oxohexanamide.
| Compound Name | 3-amino-N-[2-[[1-cyclohexa-1,3-dien-1-yl-2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl]-2-oxohexanamide |
|---|---|
| PubChem CID | 70321456 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 3-amino-N-[2-[[1-cyclohexa-1,3-dien-1-yl-2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl]-2-oxohexanamide |
| SMILES | CCCC(N)C(=O)C(=O)NCC(=O)NC(C(=O)N(C)C)C1=CC=CCC1 |
| InChI | InChI=1S/C18H28N4O4/c1-4-8-13(19)16(24)17(25)20-11-14(23)21-15(18(26)22(2)3)12-9-6-5-7-10-12/h5-6,9,13,15H,4,7-8,10-11,19H2,1-3H3,(H,20,25)(H,21,23) |
| InChIKey | SXQVXBNILARWTR-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|