C18H27N3O4 — CID 70322009
3-amino-N-[2-[[1-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]-2-oxopropyl]amino]-2-oxoethyl]-2-oxohexanamide (PubChem CID 70322009) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-amino-N-[2-[[1-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]-2-oxopropyl]amino]-2-oxoethyl]-2-oxohexanamide.
| Compound Name | 3-amino-N-[2-[[1-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]-2-oxopropyl]amino]-2-oxoethyl]-2-oxohexanamide |
|---|---|
| PubChem CID | 70322009 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 3-amino-N-[2-[[1-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]-2-oxopropyl]amino]-2-oxoethyl]-2-oxohexanamide |
| SMILES | CCCC(N)C(=O)C(=O)NCC(=O)NC(C(C)=O)C1=C[C@H](C)CC=C1 |
| InChI | InChI=1S/C18H27N3O4/c1-4-6-14(19)17(24)18(25)20-10-15(23)21-16(12(3)22)13-8-5-7-11(2)9-13/h5,8-9,11,14,16H,4,6-7,10,19H2,1-3H3,(H,20,25)(H,21,23)/t11-,14?,16?/m1/s1 |
| InChIKey | KAJGNNAMRQFNNF-OLQXHTCTSA-N |
| XLogP | 0.40 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|