C13H26N2O3 — CID 145466397
3-amino-N-(furan-2-ylmethyl)-2-oxohexanamide;ethane;molecular hydrogen (PubChem CID 145466397) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-amino-N-(furan-2-ylmethyl)-2-oxohexanamide;ethane;molecular hydrogen.
| Compound Name | 3-amino-N-(furan-2-ylmethyl)-2-oxohexanamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 145466397 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 3-amino-N-(furan-2-ylmethyl)-2-oxohexanamide;ethane;molecular hydrogen |
| SMILES | CC.CCCC(N)C(=O)C(=O)NCc1ccco1.[H][H].[H][H] |
| InChI | InChI=1S/C11H16N2O3.C2H6.2H2/c1-2-4-9(12)10(14)11(15)13-7-8-5-3-6-16-8;1-2;;/h3,5-6,9H,2,4,7,12H2,1H3,(H,13,15);1-2H3;2*1H |
| InChIKey | NNISBLQZFKEKKV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|