About (4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid
(4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 7032537) has the molecular formula C9H8N2O2S
and a molecular weight of 208.24 g/mol. Its IUPAC name is (4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
Analyze (4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The IUPAC name of (4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CID 7032537) is (4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for (4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for (4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid is O=C(O)[C@H]1CSC(c2cccnc2)=N1.
What is the InChIKey of (4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The InChIKey is LJGAQGZEJDQDAU-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H8N2O2S/c12-9(13)7-5-14-8(11-7)6-2-1-3-10-4-6/h1-4,7H,5H2,(H,12,13)/t7-/m1/s1.
What are the key properties of (4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
(4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid has a molecular weight of 208.24 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 7032537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).