About (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate
(4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 7032538) has the molecular formula C9H7N2O2S-
and a molecular weight of 207.23 g/mol. Its IUPAC name is (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate |
| PubChem CID | 7032538 |
| Molecular Formula | C9H7N2O2S- |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate |
| SMILES | O=C([O-])[C@@H]1CSC(c2cccnc2)=N1 |
| InChI | InChI=1S/C9H8N2O2S/c12-9(13)7-5-14-8(11-7)6-2-1-3-10-4-6/h1-4,7H,5H2,(H,12,13)/p-1/t7-/m0/s1 |
| InChIKey | LJGAQGZEJDQDAU-ZETCQYMHSA-M |
| XLogP | -0.31 |
| TPSA | 65.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate?
The IUPAC name of (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate (CID 7032538) is (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate.
What is the SMILES notation for (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate?
The canonical SMILES for (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate is O=C([O-])[C@@H]1CSC(c2cccnc2)=N1.
What is the InChIKey of (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate?
The InChIKey is LJGAQGZEJDQDAU-ZETCQYMHSA-M. The full InChI is InChI=1S/C9H8N2O2S/c12-9(13)7-5-14-8(11-7)6-2-1-3-10-4-6/h1-4,7H,5H2,(H,12,13)/p-1/t7-/m0/s1.
What are the key properties of (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate?
(4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate has a molecular weight of 207.23 g/mol, XLogP of -0.31, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 7032538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).