C33H37N3O5 — CID 70325560
(3R,4S)-N-cyclopropyl-4-(3-hydroxy-5-phenylphenyl)-N-[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]piperidine-3-carboxamide (PubChem CID 70325560) has the molecular formula C33H37N3O5 and a molecular weight of 555.68 g/mol. Its IUPAC name is (3R,4S)-N-cyclopropyl-4-(3-hydroxy-5-phenylphenyl)-N-[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]piperidine-3-carboxamide.
| Compound Name | (3R,4S)-N-cyclopropyl-4-(3-hydroxy-5-phenylphenyl)-N-[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 70325560 |
| Molecular Formula | C33H37N3O5 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | (3R,4S)-N-cyclopropyl-4-(3-hydroxy-5-phenylphenyl)-N-[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]piperidine-3-carboxamide |
| SMILES | COCCCN1C(=O)COc2ccc(N(C(=O)[C@H]3CNCC[C@@H]3c3cc(O)cc(-c4ccccc4)c3)C3CC3)cc21 |
| InChI | InChI=1S/C33H37N3O5/c1-40-15-5-14-35-30-19-26(10-11-31(30)41-21-32(35)38)36(25-8-9-25)33(39)29-20-34-13-12-28(29)24-16-23(17-27(37)18-24)22-6-3-2-4-7-22/h2-4,6-7,10-11,16-19,25,28-29,34,37H,5,8-9,12-15,20-21H2,1H3/t28-,29+/m1/s1 |
| InChIKey | BXUSINGBYHSHSL-WDYNHAJCSA-N |
| XLogP | 4.71 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|