C32H40N4O4 — CID 70951508
(3R,4S)-N-cyclopropyl-4-[3-(3,6-dihydro-2H-pyridin-1-yl)phenyl]-N-[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]piperidine-3-carboxamide (PubChem CID 70951508) has the molecular formula C32H40N4O4 and a molecular weight of 544.70 g/mol. Its IUPAC name is (3R,4S)-N-cyclopropyl-4-[3-(3,6-dihydro-2H-pyridin-1-yl)phenyl]-N-[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]piperidine-3-carboxamide.
| Compound Name | (3R,4S)-N-cyclopropyl-4-[3-(3,6-dihydro-2H-pyridin-1-yl)phenyl]-N-[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 70951508 |
| Molecular Formula | C32H40N4O4 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | (3R,4S)-N-cyclopropyl-4-[3-(3,6-dihydro-2H-pyridin-1-yl)phenyl]-N-[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]piperidine-3-carboxamide |
| SMILES | COCCCN1C(=O)COc2ccc(N(C(=O)[C@H]3CNCC[C@@H]3c3cccc(N4CC=CCC4)c3)C3CC3)cc21 |
| InChI | InChI=1S/C32H40N4O4/c1-39-18-6-17-35-29-20-26(11-12-30(29)40-22-31(35)37)36(24-9-10-24)32(38)28-21-33-14-13-27(28)23-7-5-8-25(19-23)34-15-3-2-4-16-34/h2-3,5,7-8,11-12,19-20,24,27-28,33H,4,6,9-10,13-18,21-22H2,1H3/t27-,28+/m1/s1 |
| InChIKey | AQWKVPJSMLOKQL-IZLXSDGUSA-N |
| XLogP | 4.10 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|