C35H39N3O6 — CID 70894579
methyl 4-[3-[(3R,4S)-3-[cyclopropyl-[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]carbamoyl]piperidin-4-yl]phenyl]benzoate (PubChem CID 70894579) has the molecular formula C35H39N3O6 and a molecular weight of 597.71 g/mol. Its IUPAC name is methyl 4-[3-[(3R,4S)-3-[cyclopropyl-[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]carbamoyl]piperidin-4-yl]phenyl]benzoate.
| Compound Name | methyl 4-[3-[(3R,4S)-3-[cyclopropyl-[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]carbamoyl]piperidin-4-yl]phenyl]benzoate |
|---|---|
| PubChem CID | 70894579 |
| Molecular Formula | C35H39N3O6 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | methyl 4-[3-[(3R,4S)-3-[cyclopropyl-[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]carbamoyl]piperidin-4-yl]phenyl]benzoate |
| SMILES | COCCCN1C(=O)COc2ccc(N(C(=O)[C@H]3CNCC[C@@H]3c3cccc(-c4ccc(C(=O)OC)cc4)c3)C3CC3)cc21 |
| InChI | InChI=1S/C35H39N3O6/c1-42-18-4-17-37-31-20-28(13-14-32(31)44-22-33(37)39)38(27-11-12-27)34(40)30-21-36-16-15-29(30)26-6-3-5-25(19-26)23-7-9-24(10-8-23)35(41)43-2/h3,5-10,13-14,19-20,27,29-30,36H,4,11-12,15-18,21-22H2,1-2H3/t29-,30+/m1/s1 |
| InChIKey | IZYWKCHGECQNKM-IHLOFXLRSA-N |
| XLogP | 4.79 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|