C29H29FN4O3 — CID 70328118
4-[[6-fluoro-2-[4-[2-(morpholin-4-ylmethyl)phenyl]phenyl]quinazolin-4-yl]amino]butanoic acid (PubChem CID 70328118) has the molecular formula C29H29FN4O3 and a molecular weight of 500.57 g/mol. Its IUPAC name is 4-[[6-fluoro-2-[4-[2-(morpholin-4-ylmethyl)phenyl]phenyl]quinazolin-4-yl]amino]butanoic acid.
| Compound Name | 4-[[6-fluoro-2-[4-[2-(morpholin-4-ylmethyl)phenyl]phenyl]quinazolin-4-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 70328118 |
| Molecular Formula | C29H29FN4O3 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 4-[[6-fluoro-2-[4-[2-(morpholin-4-ylmethyl)phenyl]phenyl]quinazolin-4-yl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1nc(-c2ccc(-c3ccccc3CN3CCOCC3)cc2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C29H29FN4O3/c30-23-11-12-26-25(18-23)29(31-13-3-6-27(35)36)33-28(32-26)21-9-7-20(8-10-21)24-5-2-1-4-22(24)19-34-14-16-37-17-15-34/h1-2,4-5,7-12,18H,3,6,13-17,19H2,(H,35,36)(H,31,32,33) |
| InChIKey | ZESSEAULVLLEFK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|