C32H26N4O2 — CID 70331599
ethyl 3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (PubChem CID 70331599) has the molecular formula C32H26N4O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is ethyl 3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine-5-carboxylate.
| Compound Name | ethyl 3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 70331599 |
| Molecular Formula | C32H26N4O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | ethyl 3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2[nH]cc(-c3cnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3)c2c1 |
| InChI | InChI=1S/C32H26N4O2/c1-2-38-31(37)23-18-28-29(21-34-30(28)33-19-23)24-20-35-36(22-24)32(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-22H,2H2,1H3,(H,33,34) |
| InChIKey | NVKQINCEBKBWQW-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|