C24H20N2O2 — CID 70332201
2-tert-butyl-5-(4-dibenzofuran-4-ylphenyl)-1,3,4-oxadiazole (PubChem CID 70332201) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-tert-butyl-5-(4-dibenzofuran-4-ylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-tert-butyl-5-(4-dibenzofuran-4-ylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 70332201 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-tert-butyl-5-(4-dibenzofuran-4-ylphenyl)-1,3,4-oxadiazole |
| SMILES | CC(C)(C)c1nnc(-c2ccc(-c3cccc4c3oc3ccccc34)cc2)o1 |
| InChI | InChI=1S/C24H20N2O2/c1-24(2,3)23-26-25-22(28-23)16-13-11-15(12-14-16)17-8-6-9-19-18-7-4-5-10-20(18)27-21(17)19/h4-14H,1-3H3 |
| InChIKey | CWMRNXKRAOCIHY-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |