C28H46N4O6 — CID 70333047
tert-butyl N-[(2S)-1-[(1R,2S,5S)-2-[[1-cyclopropyl-2-hydroxy-3-oxo-3-(prop-2-enylamino)propyl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 70333047) has the molecular formula C28H46N4O6 and a molecular weight of 534.70 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(1R,2S,5S)-2-[[1-cyclopropyl-2-hydroxy-3-oxo-3-(prop-2-enylamino)propyl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(1R,2S,5S)-2-[[1-cyclopropyl-2-hydroxy-3-oxo-3-(prop-2-enylamino)propyl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 70333047 |
| Molecular Formula | C28H46N4O6 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(1R,2S,5S)-2-[[1-cyclopropyl-2-hydroxy-3-oxo-3-(prop-2-enylamino)propyl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | C=CCNC(=O)C(O)C(NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C2(C)C)C1CC1 |
| InChI | InChI=1S/C28H46N4O6/c1-10-13-29-23(35)20(33)18(15-11-12-15)30-22(34)19-17-16(28(17,8)9)14-32(19)24(36)21(26(2,3)4)31-25(37)38-27(5,6)7/h10,15-21,33H,1,11-14H2,2-9H3,(H,29,35)(H,30,34)(H,31,37)/t16-,17-,18?,19-,20?,21+/m0/s1 |
| InChIKey | MGKGPTYXDMZWOG-JNCQHCEUSA-N |
| XLogP | 1.97 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|