About 2,3,5-trimethyl-3,4-dihydropyridine
2,3,5-trimethyl-3,4-dihydropyridine (PubChem CID 70334290) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 2,3,5-trimethyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 2,3,5-trimethyl-3,4-dihydropyridine |
| PubChem CID | 70334290 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 2,3,5-trimethyl-3,4-dihydropyridine |
| SMILES | CC1=CN=C(C)C(C)C1 |
| InChI | InChI=1S/C8H13N/c1-6-4-7(2)8(3)9-5-6/h5,7H,4H2,1-3H3 |
| InChIKey | MTAAVPGSFSHPRC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,5-trimethyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-trimethyl-3,4-dihydropyridine?
The IUPAC name of 2,3,5-trimethyl-3,4-dihydropyridine (CID 70334290) is 2,3,5-trimethyl-3,4-dihydropyridine.
What is the SMILES notation for 2,3,5-trimethyl-3,4-dihydropyridine?
The canonical SMILES for 2,3,5-trimethyl-3,4-dihydropyridine is CC1=CN=C(C)C(C)C1.
What is the InChIKey of 2,3,5-trimethyl-3,4-dihydropyridine?
The InChIKey is MTAAVPGSFSHPRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-6-4-7(2)8(3)9-5-6/h5,7H,4H2,1-3H3.
What are the key properties of 2,3,5-trimethyl-3,4-dihydropyridine?
2,3,5-trimethyl-3,4-dihydropyridine has a molecular weight of 123.20 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-trimethyl-3,4-dihydropyridine is sourced from PubChem (CID 70334290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).