C29H35N5O — CID 70338434
2-[[amino-(4-phenylanilino)methylidene]amino]-3-phenyl-N-(3-pyrrolidin-1-ylpropyl)propanamide (PubChem CID 70338434) has the molecular formula C29H35N5O and a molecular weight of 469.63 g/mol. Its IUPAC name is 2-[[amino-(4-phenylanilino)methylidene]amino]-3-phenyl-N-(3-pyrrolidin-1-ylpropyl)propanamide.
| Compound Name | 2-[[amino-(4-phenylanilino)methylidene]amino]-3-phenyl-N-(3-pyrrolidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 70338434 |
| Molecular Formula | C29H35N5O |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 2-[[amino-(4-phenylanilino)methylidene]amino]-3-phenyl-N-(3-pyrrolidin-1-ylpropyl)propanamide |
| SMILES | N/C(=N\C(Cc1ccccc1)C(=O)NCCCN1CCCC1)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H35N5O/c30-29(32-26-16-14-25(15-17-26)24-12-5-2-6-13-24)33-27(22-23-10-3-1-4-11-23)28(35)31-18-9-21-34-19-7-8-20-34/h1-6,10-17,27H,7-9,18-22H2,(H,31,35)(H3,30,32,33) |
| InChIKey | FHPYHPZWTFRREB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|