C17H18N2O6 — CID 70342789
(2S,5S)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidine-2,5-dicarboxylic acid (PubChem CID 70342789) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is (2S,5S)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidine-2,5-dicarboxylic acid.
| Compound Name | (2S,5S)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidine-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70342789 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (2S,5S)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidine-2,5-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1CC[C@@H](C(=O)O)N(CCN2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C17H18N2O6/c20-14-11-3-1-2-4-12(11)15(21)19(14)8-7-18-9-10(16(22)23)5-6-13(18)17(24)25/h1-4,10,13H,5-9H2,(H,22,23)(H,24,25)/t10-,13-/m0/s1 |
| InChIKey | IVERAMDIPRXHJZ-GWCFXTLKSA-N |
| XLogP | 0.53 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|