C24H21Cl2NO4 — CID 7034493
[2-(benzamidomethyl)-4,6-dimethylphenyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 7034493) has the molecular formula C24H21Cl2NO4 and a molecular weight of 458.34 g/mol. Its IUPAC name is [2-(benzamidomethyl)-4,6-dimethylphenyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [2-(benzamidomethyl)-4,6-dimethylphenyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 7034493 |
| Molecular Formula | C24H21Cl2NO4 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | [2-(benzamidomethyl)-4,6-dimethylphenyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | Cc1cc(C)c(OC(=O)COc2ccc(Cl)cc2Cl)c(CNC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H21Cl2NO4/c1-15-10-16(2)23(18(11-15)13-27-24(29)17-6-4-3-5-7-17)31-22(28)14-30-21-9-8-19(25)12-20(21)26/h3-12H,13-14H2,1-2H3,(H,27,29) |
| InChIKey | JTQHHEOZVKNKLK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|