C19H16F3N3O2S — CID 70346500
4-methyl-5-methylsulfanyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-4-ium-3-one hydroxide (PubChem CID 70346500) has the molecular formula C19H16F3N3O2S and a molecular weight of 407.42 g/mol. Its IUPAC name is 4-methyl-5-methylsulfanyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-4-ium-3-one hydroxide.
| Compound Name | 4-methyl-5-methylsulfanyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-4-ium-3-one hydroxide |
|---|---|
| PubChem CID | 70346500 |
| Molecular Formula | C19H16F3N3O2S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 4-methyl-5-methylsulfanyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-4-ium-3-one hydroxide |
| SMILES | CSc1c2ccccc2c2[nH]n(-c3ccc(C(F)(F)F)cc3)c(=O)c2[n+]1C.[OH-] |
| InChI | InChI=1S/C19H14F3N3OS.H2O/c1-24-16-15(13-5-3-4-6-14(13)18(24)27-2)23-25(17(16)26)12-9-7-11(8-10-12)19(20,21)22;/h3-10H,1-2H3;1H2 |
| InChIKey | CDKXHXTYKNQECX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|