C19H15F3N3O+ — CID 54316656
4,5-dimethyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-4-ium-3-one (PubChem CID 54316656) has the molecular formula C19H15F3N3O+ and a molecular weight of 358.34 g/mol. Its IUPAC name is 4,5-dimethyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-4-ium-3-one.
| Compound Name | 4,5-dimethyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-4-ium-3-one |
|---|---|
| PubChem CID | 54316656 |
| Molecular Formula | C19H15F3N3O+ |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 4,5-dimethyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-4-ium-3-one |
| SMILES | Cc1c2ccccc2c2[nH]n(-c3ccc(C(F)(F)F)cc3)c(=O)c2[n+]1C |
| InChI | InChI=1S/C19H14F3N3O/c1-11-14-5-3-4-6-15(14)16-17(24(11)2)18(26)25(23-16)13-9-7-12(8-10-13)19(20,21)22/h3-10H,1-2H3/p+1 |
| InChIKey | SORITPDRTWMITC-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|