C17H13N3O2 — CID 10851116
5-methyl-2-phenyl-1H-pyrazolo[4,3-c]quinoline-3,4-dione (PubChem CID 10851116) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 5-methyl-2-phenyl-1H-pyrazolo[4,3-c]quinoline-3,4-dione.
| Compound Name | 5-methyl-2-phenyl-1H-pyrazolo[4,3-c]quinoline-3,4-dione |
|---|---|
| PubChem CID | 10851116 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 5-methyl-2-phenyl-1H-pyrazolo[4,3-c]quinoline-3,4-dione |
| SMILES | Cn1c(=O)c2c(=O)n(-c3ccccc3)[nH]c2c2ccccc21 |
| InChI | InChI=1S/C17H13N3O2/c1-19-13-10-6-5-9-12(13)15-14(16(19)21)17(22)20(18-15)11-7-3-2-4-8-11/h2-10,18H,1H3 |
| InChIKey | OQYPXJHWJZVHCC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|