C32H43FN2O6SSi — CID 70348276
ethyl 2-[[3-(3-fluorophenyl)propyl-[(2R)-2-(4-methoxyphenyl)-2-(2-trimethylsilylethoxymethoxy)acetyl]amino]methyl]-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 70348276) has the molecular formula C32H43FN2O6SSi and a molecular weight of 630.86 g/mol. Its IUPAC name is ethyl 2-[[3-(3-fluorophenyl)propyl-[(2R)-2-(4-methoxyphenyl)-2-(2-trimethylsilylethoxymethoxy)acetyl]amino]methyl]-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[3-(3-fluorophenyl)propyl-[(2R)-2-(4-methoxyphenyl)-2-(2-trimethylsilylethoxymethoxy)acetyl]amino]methyl]-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 70348276 |
| Molecular Formula | C32H43FN2O6SSi |
| Molecular Weight | 630.86 g/mol |
| Exact Mass | 630.26 |
| IUPAC Name | ethyl 2-[[3-(3-fluorophenyl)propyl-[(2R)-2-(4-methoxyphenyl)-2-(2-trimethylsilylethoxymethoxy)acetyl]amino]methyl]-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(CN(CCCc2cccc(F)c2)C(=O)[C@H](OCOCC[Si](C)(C)C)c2ccc(OC)cc2)sc1C |
| InChI | InChI=1S/C32H43FN2O6SSi/c1-7-40-32(37)29-23(2)42-28(34-29)21-35(17-9-11-24-10-8-12-26(33)20-24)31(36)30(25-13-15-27(38-3)16-14-25)41-22-39-18-19-43(4,5)6/h8,10,12-16,20,30H,7,9,11,17-19,21-22H2,1-6H3/t30-/m1/s1 |
| InChIKey | QTQYBDPKMBZEFF-SSEXGKCCSA-N |
| XLogP | 6.81 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.86 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|