C31H41BrN2O6SSi — CID 70348388
ethyl 5-bromo-2-[[[(2R)-2-(4-methoxyphenyl)-2-(2-trimethylsilylethoxymethoxy)acetyl]-(3-phenylpropyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 70348388) has the molecular formula C31H41BrN2O6SSi and a molecular weight of 677.73 g/mol. Its IUPAC name is ethyl 5-bromo-2-[[[(2R)-2-(4-methoxyphenyl)-2-(2-trimethylsilylethoxymethoxy)acetyl]-(3-phenylpropyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-bromo-2-[[[(2R)-2-(4-methoxyphenyl)-2-(2-trimethylsilylethoxymethoxy)acetyl]-(3-phenylpropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 70348388 |
| Molecular Formula | C31H41BrN2O6SSi |
| Molecular Weight | 677.73 g/mol |
| Exact Mass | 676.16 |
| IUPAC Name | ethyl 5-bromo-2-[[[(2R)-2-(4-methoxyphenyl)-2-(2-trimethylsilylethoxymethoxy)acetyl]-(3-phenylpropyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(CN(CCCc2ccccc2)C(=O)[C@H](OCOCC[Si](C)(C)C)c2ccc(OC)cc2)sc1Br |
| InChI | InChI=1S/C31H41BrN2O6SSi/c1-6-39-31(36)27-29(32)41-26(33-27)21-34(18-10-13-23-11-8-7-9-12-23)30(35)28(24-14-16-25(37-2)17-15-24)40-22-38-19-20-42(3,4)5/h7-9,11-12,14-17,28H,6,10,13,18-22H2,1-5H3/t28-/m1/s1 |
| InChIKey | KLBSODRPIWVUCJ-MUUNZHRXSA-N |
| XLogP | 7.12 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.73 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|