About (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate
(8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate (PubChem CID 70348371) has the molecular formula C17H14ClN3O4
and a molecular weight of 359.77 g/mol. Its IUPAC name is (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate |
| PubChem CID | 70348371 |
| Molecular Formula | C17H14ClN3O4 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate |
| SMILES | O=C(Oc1cc(=O)cc2oc3ccc(Cl)cc3nc1-2)N1CCNCC1 |
| InChI | InChI=1S/C17H14ClN3O4/c18-10-1-2-13-12(7-10)20-16-14(24-13)8-11(22)9-15(16)25-17(23)21-5-3-19-4-6-21/h1-2,7-9,19H,3-6H2 |
| InChIKey | GLYAMOJBWQOGDY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate?
The IUPAC name of (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate (CID 70348371) is (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate.
What is the SMILES notation for (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate?
The canonical SMILES for (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate is O=C(Oc1cc(=O)cc2oc3ccc(Cl)cc3nc1-2)N1CCNCC1.
What is the InChIKey of (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate?
The InChIKey is GLYAMOJBWQOGDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN3O4/c18-10-1-2-13-12(7-10)20-16-14(24-13)8-11(22)9-15(16)25-17(23)21-5-3-19-4-6-21/h1-2,7-9,19H,3-6H2.
What are the key properties of (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate?
(8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate has a molecular weight of 359.77 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (8-chloro-3-oxophenoxazin-1-yl) piperazine-1-carboxylate is sourced from PubChem (CID 70348371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).