C13H13N3O7S — CID 70350063
6-methyl-3-methylsulfonyl-4-(2-nitrophenyl)-2-oxo-1,6-dihydropyrimidine-5-carboxylic acid (PubChem CID 70350063) has the molecular formula C13H13N3O7S and a molecular weight of 355.33 g/mol. Its IUPAC name is 6-methyl-3-methylsulfonyl-4-(2-nitrophenyl)-2-oxo-1,6-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 6-methyl-3-methylsulfonyl-4-(2-nitrophenyl)-2-oxo-1,6-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 70350063 |
| Molecular Formula | C13H13N3O7S |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 6-methyl-3-methylsulfonyl-4-(2-nitrophenyl)-2-oxo-1,6-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC1NC(=O)N(S(C)(=O)=O)C(c2ccccc2[N+](=O)[O-])=C1C(=O)O |
| InChI | InChI=1S/C13H13N3O7S/c1-7-10(12(17)18)11(15(13(19)14-7)24(2,22)23)8-5-3-4-6-9(8)16(20)21/h3-7H,1-2H3,(H,14,19)(H,17,18) |
| InChIKey | XBISRAOOOHQBFF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|