About 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline
2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline (PubChem CID 70351332) has the molecular formula C23H25NO3
and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline.
Molecular Properties
| Compound Name | 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline |
| PubChem CID | 70351332 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline |
| SMILES | CC(C(=O)O)C(=O)c1ccccc1.CC(C)Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C13H15N.C10H10O3/c1-10(2)8-11-5-6-13-12(9-11)4-3-7-14-13;1-7(10(12)13)9(11)8-5-3-2-4-6-8/h3-7,9-10H,8H2,1-2H3;2-7H,1H3,(H,12,13) |
| InChIKey | RUAIRTLKSFGXRP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline?
The IUPAC name of 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline (CID 70351332) is 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline.
What is the SMILES notation for 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline?
The canonical SMILES for 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline is CC(C(=O)O)C(=O)c1ccccc1.CC(C)Cc1ccc2ncccc2c1.
What is the InChIKey of 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline?
The InChIKey is RUAIRTLKSFGXRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N.C10H10O3/c1-10(2)8-11-5-6-13-12(9-11)4-3-7-14-13;1-7(10(12)13)9(11)8-5-3-2-4-6-8/h3-7,9-10H,8H2,1-2H3;2-7H,1H3,(H,12,13).
What are the key properties of 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline?
2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline has a molecular weight of 363.46 g/mol, XLogP of 5.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-oxo-3-phenylpropanoic acid;6-(2-methylpropyl)quinoline is sourced from PubChem (CID 70351332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).