C27H31N5O4 — CID 70354422
5-methyl-7-(3-nitrophenyl)-1-phenyl-2-(2-piperidin-1-ylethyl)-4,7-dihydro-2H-pyrazolo[1,5-a]pyrimidine-6-carboxylic acid (PubChem CID 70354422) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is 5-methyl-7-(3-nitrophenyl)-1-phenyl-2-(2-piperidin-1-ylethyl)-4,7-dihydro-2H-pyrazolo[1,5-a]pyrimidine-6-carboxylic acid.
| Compound Name | 5-methyl-7-(3-nitrophenyl)-1-phenyl-2-(2-piperidin-1-ylethyl)-4,7-dihydro-2H-pyrazolo[1,5-a]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 70354422 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 5-methyl-7-(3-nitrophenyl)-1-phenyl-2-(2-piperidin-1-ylethyl)-4,7-dihydro-2H-pyrazolo[1,5-a]pyrimidine-6-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)N2C(=CC(CCN3CCCCC3)N2c2ccccc2)N1 |
| InChI | InChI=1S/C27H31N5O4/c1-19-25(27(33)34)26(20-9-8-12-23(17-20)32(35)36)31-24(28-19)18-22(13-16-29-14-6-3-7-15-29)30(31)21-10-4-2-5-11-21/h2,4-5,8-12,17-18,22,26,28H,3,6-7,13-16H2,1H3,(H,33,34) |
| InChIKey | SYPPGILHCLLQHO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|