About 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate
2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate (PubChem CID 70354493) has the molecular formula C13H14FNO3
and a molecular weight of 251.26 g/mol. Its IUPAC name is 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate |
| PubChem CID | 70354493 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate |
| SMILES | O=C1CCCN1C(=O)OCCc1cccc(F)c1 |
| InChI | InChI=1S/C13H14FNO3/c14-11-4-1-3-10(9-11)6-8-18-13(17)15-7-2-5-12(15)16/h1,3-4,9H,2,5-8H2 |
| InChIKey | TWSPKLNJAMJHHW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate?
The IUPAC name of 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate (CID 70354493) is 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate.
What is the SMILES notation for 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate?
The canonical SMILES for 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate is O=C1CCCN1C(=O)OCCc1cccc(F)c1.
What is the InChIKey of 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate?
The InChIKey is TWSPKLNJAMJHHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FNO3/c14-11-4-1-3-10(9-11)6-8-18-13(17)15-7-2-5-12(15)16/h1,3-4,9H,2,5-8H2.
What are the key properties of 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate?
2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate has a molecular weight of 251.26 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluorophenyl)ethyl 2-oxopyrrolidine-1-carboxylate is sourced from PubChem (CID 70354493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).