C20H34N2O5S2 — CID 70356495
2-(2-aminopropanoyl)-1-[(2R)-3-(2-cyclopentylsulfanylethylsulfanyl)-1-ethoxy-1-oxopropan-2-yl]pyrrolidine-2-carboxylic acid (PubChem CID 70356495) has the molecular formula C20H34N2O5S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-(2-aminopropanoyl)-1-[(2R)-3-(2-cyclopentylsulfanylethylsulfanyl)-1-ethoxy-1-oxopropan-2-yl]pyrrolidine-2-carboxylic acid.
| Compound Name | 2-(2-aminopropanoyl)-1-[(2R)-3-(2-cyclopentylsulfanylethylsulfanyl)-1-ethoxy-1-oxopropan-2-yl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70356495 |
| Molecular Formula | C20H34N2O5S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-(2-aminopropanoyl)-1-[(2R)-3-(2-cyclopentylsulfanylethylsulfanyl)-1-ethoxy-1-oxopropan-2-yl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)[C@H](CSCCSC1CCCC1)N1CCCC1(C(=O)O)C(=O)C(C)N |
| InChI | InChI=1S/C20H34N2O5S2/c1-3-27-18(24)16(13-28-11-12-29-15-7-4-5-8-15)22-10-6-9-20(22,19(25)26)17(23)14(2)21/h14-16H,3-13,21H2,1-2H3,(H,25,26)/t14?,16-,20?/m0/s1 |
| InChIKey | QLEIAFOVMRMVKV-FXUPRZHBSA-N |
| XLogP | 2.16 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|