C24H42N2O7S — CID 70446092
2-(2-aminopropanoyl)-1-[(2R)-1-ethoxy-3-(1-ethoxy-1-oxononan-2-yl)sulfanyl-1-oxopropan-2-yl]pyrrolidine-2-carboxylic acid (PubChem CID 70446092) has the molecular formula C24H42N2O7S and a molecular weight of 502.67 g/mol. Its IUPAC name is 2-(2-aminopropanoyl)-1-[(2R)-1-ethoxy-3-(1-ethoxy-1-oxononan-2-yl)sulfanyl-1-oxopropan-2-yl]pyrrolidine-2-carboxylic acid.
| Compound Name | 2-(2-aminopropanoyl)-1-[(2R)-1-ethoxy-3-(1-ethoxy-1-oxononan-2-yl)sulfanyl-1-oxopropan-2-yl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70446092 |
| Molecular Formula | C24H42N2O7S |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 2-(2-aminopropanoyl)-1-[(2R)-1-ethoxy-3-(1-ethoxy-1-oxononan-2-yl)sulfanyl-1-oxopropan-2-yl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCCCCCC(SC[C@@H](C(=O)OCC)N1CCCC1(C(=O)O)C(=O)C(C)N)C(=O)OCC |
| InChI | InChI=1S/C24H42N2O7S/c1-5-8-9-10-11-13-19(22(29)33-7-3)34-16-18(21(28)32-6-2)26-15-12-14-24(26,23(30)31)20(27)17(4)25/h17-19H,5-16,25H2,1-4H3,(H,30,31)/t17?,18-,19?,24?/m0/s1 |
| InChIKey | OYTUYYUQLXKKFE-NQVYWQGOSA-N |
| XLogP | 2.78 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|