C20H36N2O5S — CID 70446114
2-(2-aminopropanoyl)-1-[(2R)-1-ethoxy-3-heptylsulfanyl-1-oxopropan-2-yl]pyrrolidine-2-carboxylic acid (PubChem CID 70446114) has the molecular formula C20H36N2O5S and a molecular weight of 416.58 g/mol. Its IUPAC name is 2-(2-aminopropanoyl)-1-[(2R)-1-ethoxy-3-heptylsulfanyl-1-oxopropan-2-yl]pyrrolidine-2-carboxylic acid.
| Compound Name | 2-(2-aminopropanoyl)-1-[(2R)-1-ethoxy-3-heptylsulfanyl-1-oxopropan-2-yl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70446114 |
| Molecular Formula | C20H36N2O5S |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2-(2-aminopropanoyl)-1-[(2R)-1-ethoxy-3-heptylsulfanyl-1-oxopropan-2-yl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCCCCCSC[C@@H](C(=O)OCC)N1CCCC1(C(=O)O)C(=O)C(C)N |
| InChI | InChI=1S/C20H36N2O5S/c1-4-6-7-8-9-13-28-14-16(18(24)27-5-2)22-12-10-11-20(22,19(25)26)17(23)15(3)21/h15-16H,4-14,21H2,1-3H3,(H,25,26)/t15?,16-,20?/m0/s1 |
| InChIKey | GOFRKMUIKGRVQX-NGEICVOHSA-N |
| XLogP | 2.46 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|