C23H34Cl2N4 — CID 70357365
14,15-dimethyl-N-(2-piperidin-1-ylethyl)-3,4-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2,4,6,13,15-hexaen-5-amine;dihydrochloride (PubChem CID 70357365) has the molecular formula C23H34Cl2N4 and a molecular weight of 437.46 g/mol. Its IUPAC name is 14,15-dimethyl-N-(2-piperidin-1-ylethyl)-3,4-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2,4,6,13,15-hexaen-5-amine;dihydrochloride.
| Compound Name | 14,15-dimethyl-N-(2-piperidin-1-ylethyl)-3,4-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2,4,6,13,15-hexaen-5-amine;dihydrochloride |
|---|---|
| PubChem CID | 70357365 |
| Molecular Formula | C23H34Cl2N4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 14,15-dimethyl-N-(2-piperidin-1-ylethyl)-3,4-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2,4,6,13,15-hexaen-5-amine;dihydrochloride |
| SMILES | Cc1cc2c(cc1C)-c1nnc(NCCN3CCCCC3)cc1CCCC2.Cl.Cl |
| InChI | InChI=1S/C23H32N4.2ClH/c1-17-14-19-8-4-5-9-20-16-22(24-10-13-27-11-6-3-7-12-27)25-26-23(20)21(19)15-18(17)2;;/h14-16H,3-13H2,1-2H3,(H,24,25);2*1H |
| InChIKey | XASSODXHOXVYKJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |