C19H24Cl2N4 — CID 70357391
N-(13,14-dichloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-N',N'-diethylethane-1,2-diamine (PubChem CID 70357391) has the molecular formula C19H24Cl2N4 and a molecular weight of 379.34 g/mol. Its IUPAC name is N-(13,14-dichloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(13,14-dichloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 70357391 |
| Molecular Formula | C19H24Cl2N4 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-(13,14-dichloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1cc2c(nn1)-c1cc(Cl)c(Cl)cc1CCC2 |
| InChI | InChI=1S/C19H24Cl2N4/c1-3-25(4-2)9-8-22-18-11-14-7-5-6-13-10-16(20)17(21)12-15(13)19(14)24-23-18/h10-12H,3-9H2,1-2H3,(H,22,23) |
| InChIKey | UTPPWSMVKAQJPN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |