C19H25ClN4 — CID 70357401
N-(14-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl)-N',N'-diethylethane-1,2-diamine (PubChem CID 70357401) has the molecular formula C19H25ClN4 and a molecular weight of 344.89 g/mol. Its IUPAC name is N-(14-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(14-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 70357401 |
| Molecular Formula | C19H25ClN4 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-(14-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1cc2c(nn1)-c1cc(Cl)ccc1CCC2 |
| InChI | InChI=1S/C19H25ClN4/c1-3-24(4-2)11-10-21-18-12-15-7-5-6-14-8-9-16(20)13-17(14)19(15)23-22-18/h8-9,12-13H,3-7,10-11H2,1-2H3,(H,21,22) |
| InChIKey | VOUSQIVOGBTLTO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |