C19H27Cl3N4 — CID 70357400
N-(14-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl)-N',N'-diethylethane-1,2-diamine;dihydrochloride (PubChem CID 70357400) has the molecular formula C19H27Cl3N4 and a molecular weight of 417.81 g/mol. Its IUPAC name is N-(14-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl)-N',N'-diethylethane-1,2-diamine;dihydrochloride.
| Compound Name | N-(14-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl)-N',N'-diethylethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 70357400 |
| Molecular Formula | C19H27Cl3N4 |
| Molecular Weight | 417.81 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-(14-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl)-N',N'-diethylethane-1,2-diamine;dihydrochloride |
| SMILES | CCN(CC)CCNc1cc2c(nn1)-c1cc(Cl)ccc1CCC2.Cl.Cl |
| InChI | InChI=1S/C19H25ClN4.2ClH/c1-3-24(4-2)11-10-21-18-12-15-7-5-6-14-8-9-16(20)13-17(14)19(15)23-22-18;;/h8-9,12-13H,3-7,10-11H2,1-2H3,(H,21,22);2*1H |
| InChIKey | WQRJYHSWAQVYQB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.81 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |