C24H26N2 — CID 70359800
4-N,4-N-diethyl-1-N-(6-methyl-9H-fluoren-3-yl)benzene-1,4-diamine (PubChem CID 70359800) has the molecular formula C24H26N2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N-(6-methyl-9H-fluoren-3-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-1-N-(6-methyl-9H-fluoren-3-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 70359800 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 4-N,4-N-diethyl-1-N-(6-methyl-9H-fluoren-3-yl)benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2ccc3c(c2)-c2cc(C)ccc2C3)cc1 |
| InChI | InChI=1S/C24H26N2/c1-4-26(5-2)22-12-10-20(11-13-22)25-21-9-8-19-15-18-7-6-17(3)14-23(18)24(19)16-21/h6-14,16,25H,4-5,15H2,1-3H3 |
| InChIKey | YGOGJZGUFYWJBD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|