C23H23ClN2 — CID 70388802
1-N-(6-chloro-9H-fluoren-3-yl)-4-N-methyl-4-N-propylbenzene-1,4-diamine (PubChem CID 70388802) has the molecular formula C23H23ClN2 and a molecular weight of 362.90 g/mol. Its IUPAC name is 1-N-(6-chloro-9H-fluoren-3-yl)-4-N-methyl-4-N-propylbenzene-1,4-diamine.
| Compound Name | 1-N-(6-chloro-9H-fluoren-3-yl)-4-N-methyl-4-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 70388802 |
| Molecular Formula | C23H23ClN2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-N-(6-chloro-9H-fluoren-3-yl)-4-N-methyl-4-N-propylbenzene-1,4-diamine |
| SMILES | CCCN(C)c1ccc(Nc2ccc3c(c2)-c2cc(Cl)ccc2C3)cc1 |
| InChI | InChI=1S/C23H23ClN2/c1-3-12-26(2)21-10-8-19(9-11-21)25-20-7-5-17-13-16-4-6-18(24)14-22(16)23(17)15-20/h4-11,14-15,25H,3,12-13H2,1-2H3 |
| InChIKey | HWMBWHVTQUYWNT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|