C27H33N3O4 — CID 70360947
(8aR,12aR,13aR)-1,4-dimethoxy-8-oxo-N-[(1R)-1-phenylethyl]-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-2-carboxamide (PubChem CID 70360947) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is (8aR,12aR,13aR)-1,4-dimethoxy-8-oxo-N-[(1R)-1-phenylethyl]-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-2-carboxamide.
| Compound Name | (8aR,12aR,13aR)-1,4-dimethoxy-8-oxo-N-[(1R)-1-phenylethyl]-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 70360947 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | (8aR,12aR,13aR)-1,4-dimethoxy-8-oxo-N-[(1R)-1-phenylethyl]-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-2-carboxamide |
| SMILES | COc1cc(C(=O)N[C@H](C)c2ccccc2)c(OC)c2c1CCN1C(=O)[C@@H]3CCCN[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C27H33N3O4/c1-16(17-8-5-4-6-9-17)29-26(31)20-14-23(33-2)19-11-13-30-22(24(19)25(20)34-3)15-21-18(27(30)32)10-7-12-28-21/h4-6,8-9,14,16,18,21-22,28H,7,10-13,15H2,1-3H3,(H,29,31)/t16-,18-,21-,22-/m1/s1 |
| InChIKey | JZNVNKHTUMMTLV-LVOPCWDJSA-N |
| XLogP | 3.39 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |