C31H41N3O3 — CID 70360629
(8aS,12aS,13aR)-3-hexoxy-8-oxo-N-[(1R)-1-phenylethyl]-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-1-carboxamide (PubChem CID 70360629) has the molecular formula C31H41N3O3 and a molecular weight of 503.69 g/mol. Its IUPAC name is (8aS,12aS,13aR)-3-hexoxy-8-oxo-N-[(1R)-1-phenylethyl]-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-1-carboxamide.
| Compound Name | (8aS,12aS,13aR)-3-hexoxy-8-oxo-N-[(1R)-1-phenylethyl]-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 70360629 |
| Molecular Formula | C31H41N3O3 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | (8aS,12aS,13aR)-3-hexoxy-8-oxo-N-[(1R)-1-phenylethyl]-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-1-carboxamide |
| SMILES | CCCCCCOc1cc2c(c(C(=O)N[C@H](C)c3ccccc3)c1)[C@H]1C[C@@H]3NCCC[C@@H]3C(=O)N1CC2 |
| InChI | InChI=1S/C31H41N3O3/c1-3-4-5-9-17-37-24-18-23-14-16-34-28(20-27-25(31(34)36)13-10-15-32-27)29(23)26(19-24)30(35)33-21(2)22-11-7-6-8-12-22/h6-8,11-12,18-19,21,25,27-28,32H,3-5,9-10,13-17,20H2,1-2H3,(H,33,35)/t21-,25+,27+,28-/m1/s1 |
| InChIKey | ISHKTEBVUQIINK-NZHOUOPXSA-N |
| XLogP | 5.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|