C31H41N3O3 — CID 88606375
(8aS,12aS,13aR)-N-hexoxy-8-oxo-N-[(1R)-1-phenylethyl]-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-3-carboxamide (PubChem CID 88606375) has the molecular formula C31H41N3O3 and a molecular weight of 503.69 g/mol. Its IUPAC name is (8aS,12aS,13aR)-N-hexoxy-8-oxo-N-[(1R)-1-phenylethyl]-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-3-carboxamide.
| Compound Name | (8aS,12aS,13aR)-N-hexoxy-8-oxo-N-[(1R)-1-phenylethyl]-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 88606375 |
| Molecular Formula | C31H41N3O3 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | (8aS,12aS,13aR)-N-hexoxy-8-oxo-N-[(1R)-1-phenylethyl]-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-3-carboxamide |
| SMILES | CCCCCCON(C(=O)c1ccc2c(c1)CCN1C(=O)[C@H]3CCCN[C@H]3C[C@H]21)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C31H41N3O3/c1-3-4-5-9-19-37-34(22(2)23-11-7-6-8-12-23)30(35)25-14-15-26-24(20-25)16-18-33-29(26)21-28-27(31(33)36)13-10-17-32-28/h6-8,11-12,14-15,20,22,27-29,32H,3-5,9-10,13,16-19,21H2,1-2H3/t22-,27+,28+,29-/m1/s1 |
| InChIKey | KFBJEAFKXCWGDG-KZNIJNHCSA-N |
| XLogP | 5.60 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|