C25H33ClN4O3 — CID 70361037
3-N-[4-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]bicyclo[2.2.1]heptane-2,3-dicarboxamide (PubChem CID 70361037) has the molecular formula C25H33ClN4O3 and a molecular weight of 473.02 g/mol. Its IUPAC name is 3-N-[4-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]bicyclo[2.2.1]heptane-2,3-dicarboxamide.
| Compound Name | 3-N-[4-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]bicyclo[2.2.1]heptane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 70361037 |
| Molecular Formula | C25H33ClN4O3 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 3-N-[4-[4-(6-chloro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]bicyclo[2.2.1]heptane-2,3-dicarboxamide |
| SMILES | NC(=O)C1C2CCC(C2)C1C(=O)NCCCCN1CCC(c2noc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C25H33ClN4O3/c26-18-5-6-19-20(14-18)33-29-23(19)15-7-11-30(12-8-15)10-2-1-9-28-25(32)22-17-4-3-16(13-17)21(22)24(27)31/h5-6,14-17,21-22H,1-4,7-13H2,(H2,27,31)(H,28,32) |
| InChIKey | CTCDMACQZYGYKE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|