C14H16N2O4 — CID 70362816
3-N,3-N-bis(1-hydroxyprop-2-enyl)benzene-1,3-dicarboxamide (PubChem CID 70362816) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 3-N,3-N-bis(1-hydroxyprop-2-enyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N,3-N-bis(1-hydroxyprop-2-enyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 70362816 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-N,3-N-bis(1-hydroxyprop-2-enyl)benzene-1,3-dicarboxamide |
| SMILES | C=CC(O)N(C(=O)c1cccc(C(N)=O)c1)C(O)C=C |
| InChI | InChI=1S/C14H16N2O4/c1-3-11(17)16(12(18)4-2)14(20)10-7-5-6-9(8-10)13(15)19/h3-8,11-12,17-18H,1-2H2,(H2,15,19) |
| InChIKey | CDPHJXKDNIDWDX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|