C20H18N4O2 — CID 154094255
3-N,3-N-bis(4-aminophenyl)benzene-1,3-dicarboxamide (PubChem CID 154094255) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-N,3-N-bis(4-aminophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N,3-N-bis(4-aminophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 154094255 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-N,3-N-bis(4-aminophenyl)benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cccc(C(=O)N(c2ccc(N)cc2)c2ccc(N)cc2)c1 |
| InChI | InChI=1S/C20H18N4O2/c21-15-4-8-17(9-5-15)24(18-10-6-16(22)7-11-18)20(26)14-3-1-2-13(12-14)19(23)25/h1-12H,21-22H2,(H2,23,25) |
| InChIKey | SHIKNGWGBLVHIQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|