C32H26N4O3S2 — CID 19832579
3-N,3-N-bis[4-(4-aminophenyl)sulfanylphenyl]-5-hydroxybenzene-1,3-dicarboxamide (PubChem CID 19832579) has the molecular formula C32H26N4O3S2 and a molecular weight of 578.72 g/mol. Its IUPAC name is 3-N,3-N-bis[4-(4-aminophenyl)sulfanylphenyl]-5-hydroxybenzene-1,3-dicarboxamide.
| Compound Name | 3-N,3-N-bis[4-(4-aminophenyl)sulfanylphenyl]-5-hydroxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19832579 |
| Molecular Formula | C32H26N4O3S2 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | 3-N,3-N-bis[4-(4-aminophenyl)sulfanylphenyl]-5-hydroxybenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(O)cc(C(=O)N(c2ccc(Sc3ccc(N)cc3)cc2)c2ccc(Sc3ccc(N)cc3)cc2)c1 |
| InChI | InChI=1S/C32H26N4O3S2/c33-22-1-9-27(10-2-22)40-29-13-5-24(6-14-29)36(32(39)21-17-20(31(35)38)18-26(37)19-21)25-7-15-30(16-8-25)41-28-11-3-23(34)4-12-28/h1-19,37H,33-34H2,(H2,35,38) |
| InChIKey | RBCAMBIZLWPCOE-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 135.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|