C10H10N2O2 — CID 68671351
3-N-ethenylbenzene-1,3-dicarboxamide (PubChem CID 68671351) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-N-ethenylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-ethenylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68671351 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-N-ethenylbenzene-1,3-dicarboxamide |
| SMILES | C=CNC(=O)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C10H10N2O2/c1-2-12-10(14)8-5-3-4-7(6-8)9(11)13/h2-6H,1H2,(H2,11,13)(H,12,14) |
| InChIKey | XQDCSKOKNMYCRY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |