C23H26N2O7 — CID 70366066
(4-methoxyphenyl)methyl 2-(2-benzamido-3-oxoazetidin-2-yl)acetate;propanoic acid (PubChem CID 70366066) has the molecular formula C23H26N2O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-(2-benzamido-3-oxoazetidin-2-yl)acetate;propanoic acid.
| Compound Name | (4-methoxyphenyl)methyl 2-(2-benzamido-3-oxoazetidin-2-yl)acetate;propanoic acid |
|---|---|
| PubChem CID | 70366066 |
| Molecular Formula | C23H26N2O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-(2-benzamido-3-oxoazetidin-2-yl)acetate;propanoic acid |
| SMILES | CCC(=O)O.COc1ccc(COC(=O)CC2(NC(=O)c3ccccc3)NCC2=O)cc1 |
| InChI | InChI=1S/C20H20N2O5.C3H6O2/c1-26-16-9-7-14(8-10-16)13-27-18(24)11-20(17(23)12-21-20)22-19(25)15-5-3-2-4-6-15;1-2-3(4)5/h2-10,21H,11-13H2,1H3,(H,22,25);2H2,1H3,(H,4,5) |
| InChIKey | YXHIEAOJNBWHQA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |