C17H19NO — CID 70366538
(8S)-8-amino-7-benzyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 70366538) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is (8S)-8-amino-7-benzyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (8S)-8-amino-7-benzyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 70366538 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (8S)-8-amino-7-benzyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | N[C@@H]1c2cc(O)ccc2CCC1Cc1ccccc1 |
| InChI | InChI=1S/C17H19NO/c18-17-14(10-12-4-2-1-3-5-12)7-6-13-8-9-15(19)11-16(13)17/h1-5,8-9,11,14,17,19H,6-7,10,18H2/t14?,17-/m0/s1 |
| InChIKey | YCRCOMPMUWDEBK-JRZJBTRGSA-N |
| XLogP | 3.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |