C10H12BrNO — CID 139779177
7-amino-8-bromo-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 139779177) has the molecular formula C10H12BrNO and a molecular weight of 242.12 g/mol. Its IUPAC name is 7-amino-8-bromo-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 7-amino-8-bromo-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 139779177 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 7-amino-8-bromo-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | NC1CCc2ccc(O)cc2C1Br |
| InChI | InChI=1S/C10H12BrNO/c11-10-8-5-7(13)3-1-6(8)2-4-9(10)12/h1,3,5,9-10,13H,2,4,12H2 |
| InChIKey | VXIDOZKPJFWSOU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|