C20H26O2 — CID 70367489
2-phenyl-5-(2-phenylethyl)hexane-1,6-diol (PubChem CID 70367489) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-phenyl-5-(2-phenylethyl)hexane-1,6-diol.
| Compound Name | 2-phenyl-5-(2-phenylethyl)hexane-1,6-diol |
|---|---|
| PubChem CID | 70367489 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-phenyl-5-(2-phenylethyl)hexane-1,6-diol |
| SMILES | OCC(CCc1ccccc1)CCC(CO)c1ccccc1 |
| InChI | InChI=1S/C20H26O2/c21-15-18(12-11-17-7-3-1-4-8-17)13-14-20(16-22)19-9-5-2-6-10-19/h1-10,18,20-22H,11-16H2 |
| InChIKey | UWCLVGGZAKSAPC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |