C25H31N3O3 — CID 70367989
(8aR,12aS,13aR)-N-[(1R)-2-hydroxy-1-(3-hydroxyphenyl)ethyl]-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide (PubChem CID 70367989) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is (8aR,12aS,13aR)-N-[(1R)-2-hydroxy-1-(3-hydroxyphenyl)ethyl]-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide.
| Compound Name | (8aR,12aS,13aR)-N-[(1R)-2-hydroxy-1-(3-hydroxyphenyl)ethyl]-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide |
|---|---|
| PubChem CID | 70367989 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (8aR,12aS,13aR)-N-[(1R)-2-hydroxy-1-(3-hydroxyphenyl)ethyl]-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine-12-carboxamide |
| SMILES | O=C(N[C@@H](CO)c1cccc(O)c1)N1CCC[C@@H]2CN3CCc4ccccc4[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C25H31N3O3/c29-16-22(18-6-3-8-20(30)13-18)26-25(31)28-11-4-7-19-15-27-12-10-17-5-1-2-9-21(17)24(27)14-23(19)28/h1-3,5-6,8-9,13,19,22-24,29-30H,4,7,10-12,14-16H2,(H,26,31)/t19-,22+,23+,24-/m1/s1 |
| InChIKey | JDGHUQXEGDKAER-QLBRKBSLSA-N |
| XLogP | 3.22 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |